Products 905783-28-0
CAS 905783-28-0 is the registry number for Anticancer agent 37. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)urea (CAS 905783-28-0) is a chemical compound with the molecular formula C19H19N3O3S and a molecular weight of 369.4 g/mol. IUPAC name: 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)urea. InChIKey: ZOTACLSUTWXWJH-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)urea |
| InChIKey | ZOTACLSUTWXWJH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)NC2=NC(=CS2)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 37, orb1688574