Products 905973-32-2

CAS 905973-32-2 is the registry number for 3-(Azidomethyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(azidomethyl)benzoic acid (CAS 905973-32-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-(azidomethyl)benzoic acid. InChIKey: YHRRDHYXBMYXQF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O2
Molecular weight177.16 g/mol
IUPAC name3-(azidomethyl)benzoic acid
InChIKeyYHRRDHYXBMYXQF-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)CN=[N+]=[N-]

Computed by PubChem (NCBI)