CAS 905973-32-2 is the registry number for 3-(Azidomethyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(azidomethyl)benzoic acid (CAS 905973-32-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-(azidomethyl)benzoic acid. InChIKey: YHRRDHYXBMYXQF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-(azidomethyl)benzoic acid |
| InChIKey | YHRRDHYXBMYXQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)