CAS 90607-21-9 appears in our catalog under these names: 5-tert-Butylisoxazole-3-carboxylic acid, 95%, 5-(tert-Butyl)isoxazole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg, 100mg.
5-tert-butyl-1,2-oxazole-3-carboxylic acid (CAS 90607-21-9) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-tert-butyl-1,2-oxazole-3-carboxylic acid. InChIKey: GBFOGDDBEDQGJW-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-tert-butyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | GBFOGDDBEDQGJW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NO1)C(=O)O |
Computed by PubChem (NCBI)