Products 906147-24-8
CAS 906147-24-8 appears in our catalog under these names: PTK7/β–catenin–IN–1, PTK7/β-catenin-IN-1, 99.99%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg.
2-(1H-indol-3-yl)-2-oxo-N-(2-phenylphenyl)acetamide (CAS 906147-24-8) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-oxo-N-(2-phenylphenyl)acetamide. InChIKey: YEZRIBXANRYCPY-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-oxo-N-(2-phenylphenyl)acetamide |
| InChIKey | YEZRIBXANRYCPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC(=O)C(=O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)