CAS 906352-85-0 appears in our catalog under these names: 3-(3-Carboxyphenyl)-1-methyl-1H-pyrazole, 3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid, 3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid, 97% . Offered by: TRC, Biosynth, Thermo Scientific. Available pack sizes: 500mg, 250mg, 1g, 1000mg, 10000mg, 5000mg.
3-(1-methylpyrazol-3-yl)benzoic acid (CAS 906352-85-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(1-methylpyrazol-3-yl)benzoic acid. InChIKey: NQPMBEUYTBLTAG-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(1-methylpyrazol-3-yl)benzoic acid |
| InChIKey | NQPMBEUYTBLTAG-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)