Products 90649-78-8
CAS 90649-78-8 appears in our catalog under these names: 4-Chloro-3,5-dimethylbenzoic acid, 95%, 4-Chloro-3,5-dimethylbenzoic acid, 4-Chloro-3,5-dimethylbenzoic acid, 99%, 99%, 4-Chloro-3,5-dimethylbenzoic acid, min. 95 %, 500 mg, 4-Chloro-3,5-dimethylbenzoic acid, min. 95 %, 1 g. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Roth. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 0,5g, 500mg.
4-chloro-3,5-dimethylbenzoic acid (CAS 90649-78-8) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 4-chloro-3,5-dimethylbenzoic acid. InChIKey: ZHHGJCFPDAJYTF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 4-chloro-3,5-dimethylbenzoic acid |
| InChIKey | ZHHGJCFPDAJYTF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)C(=O)O |
Computed by PubChem (NCBI)