CAS 906657-86-1 appears in our catalog under these names: 3-(Benzyloxy)-5-bromo-2-methyl-4-pyridinol, 95%, 3-(Benzyloxy)-5-bromo-2-methyl-4-pyridinol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
5-bromo-2-methyl-3-phenylmethoxy-1H-pyridin-4-one (CAS 906657-86-1) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: 5-bromo-2-methyl-3-phenylmethoxy-1H-pyridin-4-one. InChIKey: RTPDVDCGESIMNA-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-phenylmethoxy-1H-pyridin-4-one |
| InChIKey | RTPDVDCGESIMNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C(=CN1)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)