Products 90719-29-2
CAS 90719-29-2 is the registry number for (4S)-N-Crotonyl-4-isopropyl-2-oxazolidinone, 99%. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
(4S)-3-[(E)-but-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (CAS 90719-29-2) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (4S)-3-[(E)-but-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one. InChIKey: YZRHIMNEVFYTAJ-WTSVBCDHSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (4S)-3-[(E)-but-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| InChIKey | YZRHIMNEVFYTAJ-WTSVBCDHSA-N |
| SMILES | C/C=C/C(=O)N1[C@H](COC1=O)C(C)C |
Computed by PubChem (NCBI)