CAS 907597-16-4 appears in our catalog under these names: 5-Bromo-3-chloro-1,2-benzothiazole, 95%, 5-Bromo-3-chloro-1,2-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-3-chloro-1,2-benzothiazole (CAS 907597-16-4) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 5-bromo-3-chloro-1,2-benzothiazole. InChIKey: KETKMCDPJRQYGE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 5-bromo-3-chloro-1,2-benzothiazole |
| InChIKey | KETKMCDPJRQYGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NS2)Cl |
Computed by PubChem (NCBI)