Products 90812-66-1
CAS 90812-66-1 appears in our catalog under these names: Benzoic acid, 4-(carboxymethoxy)-, 1-methyl ester, 95%, BENZOIC ACID, 4-(CARBOXYMETHOXY)-, 1-METHYL ESTER, 97%, 4-(Carboxymethoxy)benzoic acid methyl ester, 2-(4-(Methoxycarbonyl)phenoxy)acetic acid 95%, 4-(Carboxymethoxy)-benzoic acid methyl ester, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 2,5g, 500 mg, 100 mg, 250 mg, 1 g.
2-(4-methoxycarbonylphenoxy)acetic acid (CAS 90812-66-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(4-methoxycarbonylphenoxy)acetic acid. InChIKey: WCFPZVJGGGBAOQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(4-methoxycarbonylphenoxy)acetic acid |
| InChIKey | WCFPZVJGGGBAOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Carboxymethoxy)-benzoic acid 1-methyl ester, 2-(4-(methoxycarbonyl)phenoxy)acetic acid, 4-(Carboxymethoxy)-benzoic acid methyl ester, 2-(4-methoxycarbonylphenoxy)acetic acid, 2-[4-(methoxycarbonyl)phenoxy]acetic acid, 4-(Carboxymethoxy)benzoic acid methyl ester, 4-(Carboxymethoxy)benzoic Acid 1-Methyl Ester, orb3175661, WCFPZVJGGGBAOQ-UHFFFAOYSA-N, Methyl 4-(carboxymethyloxy)benzoate