CAS 90828-16-3 appears in our catalog under these names: (Z)-SU4312/ 99.84% (existing batch purity), (Z)–SU4312, (3Z)-3-{[4-(dimethylamino)phenyl]methylidene}-2,3-dihydro-1H-indol-2-one, cis-SU4312. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-2-one (CAS 90828-16-3) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: (3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-2-one. InChIKey: UAKWLVYMKBWHMX-PTNGSMBKSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-2-one |
| InChIKey | UAKWLVYMKBWHMX-PTNGSMBKSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C\2/C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)