Products 90899-22-2
CAS 90899-22-2 is the registry number for p-Hydroxybenzoylecgonine. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
3-(4-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid (CAS 90899-22-2) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: 3-(4-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid. InChIKey: GFOOTRIURAVHGP-UHFFFAOYSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | 3-(4-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| InChIKey | GFOOTRIURAVHGP-UHFFFAOYSA-N |
| SMILES | CN1C2CCC1C(C(C2)OC(=O)C3=CC=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)