CAS 90919-75-8 appears in our catalog under these names: Cyclopropyl-(3,4-dichloro-benzyl)-amine, 95+%, N-((3,4-Dichlorophenyl)methyl)cyclopropanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-[(3,4-dichlorophenyl)methyl]cyclopropanamine (CAS 90919-75-8) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]cyclopropanamine. InChIKey: ARVDJBARMJFVNT-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]cyclopropanamine |
| InChIKey | ARVDJBARMJFVNT-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)