CAS 909208-88-4 appears in our catalog under these names: 3-bromo-2,8-dimethylquinolin-4-ol, 95%, 3-Bromo-2,8-dimethylquinolin-4-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-bromo-2,8-dimethyl-1H-quinolin-4-one (CAS 909208-88-4) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 3-bromo-2,8-dimethyl-1H-quinolin-4-one. InChIKey: BLIHMHPMCKIEEQ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 3-bromo-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | BLIHMHPMCKIEEQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C(=C(N2)C)Br |
Computed by PubChem (NCBI)