Products 90923-03-8
CAS 90923-03-8 appears in our catalog under these names: Methyl 2–(4–methoxy–2–nitrophenyl)acetate, Methyl 2-(4-methoxy-2-nitrophenyl)acetate, 97%, 97%, METHYL 2-(4-METHOXY-2-NITROPHENYL) ACETATE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Methyl 2-(4-methoxy-2-nitrophenyl)acetate (CAS 90923-03-8) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: methyl 2-(4-methoxy-2-nitrophenyl)acetate. InChIKey: ZANZIKSIBCPPRQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | methyl 2-(4-methoxy-2-nitrophenyl)acetate |
| InChIKey | ZANZIKSIBCPPRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CC(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)