CAS 90923-10-7 appears in our catalog under these names: Methyl 4-(1-hydroxy-2-nitroethyl)benzoate, 90%, Methyl 4-(1-hydroxy-2-nitroethyl)benzoate 90%. Offered by: AmBeed. Available pack sizes: 5mg, 250mg, 1g, 5g.
Methyl 4-(1-hydroxy-2-nitroethyl)benzoate (CAS 90923-10-7) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: methyl 4-(1-hydroxy-2-nitroethyl)benzoate. InChIKey: LNECTYJAMWFQHJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | methyl 4-(1-hydroxy-2-nitroethyl)benzoate |
| InChIKey | LNECTYJAMWFQHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(C[N+](=O)[O-])O |
Computed by PubChem (NCBI)