CAS 90923-78-7 appears in our catalog under these names: 3-Aminonaphthalen-1-ol hydrochloride, 97%, 3-Aminonaphthalen-1-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-aminonaphthalen-1-ol;hydrochloride (CAS 90923-78-7) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 3-aminonaphthalen-1-ol;hydrochloride. InChIKey: HJBNLWHHIOXVFO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 3-aminonaphthalen-1-ol;hydrochloride |
| InChIKey | HJBNLWHHIOXVFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)N.Cl |
Computed by PubChem (NCBI)