CAS 909248-46-0 appears in our catalog under these names: 3-(4-Bromophenyl)cyclopentanone 95%, 3-(4-Bromophenyl)cyclopentanone, 95%, 95%, 3-(4-Bromophenyl)cyclopentanone, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(4-bromophenyl)cyclopentan-1-one (CAS 909248-46-0) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 3-(4-bromophenyl)cyclopentan-1-one. InChIKey: AJKPXKHWCHZLSF-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 3-(4-bromophenyl)cyclopentan-1-one |
| InChIKey | AJKPXKHWCHZLSF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CC1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)