CAS 90926-25-3 is the registry number for 4-Methylphenyl propyl sulfone, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-methyl-4-propylsulfonylbenzene (CAS 90926-25-3) is a chemical compound with the molecular formula C10H14O2S and a molecular weight of 198.28 g/mol. IUPAC name: 1-methyl-4-propylsulfonylbenzene. InChIKey: UUWYUBKTWPLKKD-UHFFFAOYSA-N.
| Molecular formula | C10H14O2S |
|---|---|
| Molecular weight | 198.28 g/mol |
| IUPAC name | 1-methyl-4-propylsulfonylbenzene |
| InChIKey | UUWYUBKTWPLKKD-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)