Products 909390-56-3
CAS 909390-56-3 is the registry number for N-(2,6-Dimethylphenyl)-N-[(tetrahydro-1,1-dioxido-2H-thiopyran-4-yl)carbonyl]glycine, 94.7%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
2-(N-(1,1-dioxothiane-4-carbonyl)-2,6-dimethylanilino)acetic acid (CAS 909390-56-3) is a chemical compound with the molecular formula C16H21NO5S and a molecular weight of 339.4 g/mol. IUPAC name: 2-(N-(1,1-dioxothiane-4-carbonyl)-2,6-dimethylanilino)acetic acid. InChIKey: CXNXCSKMGQQYCC-UHFFFAOYSA-N.
| Molecular formula | C16H21NO5S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-(N-(1,1-dioxothiane-4-carbonyl)-2,6-dimethylanilino)acetic acid |
| InChIKey | CXNXCSKMGQQYCC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(CC(=O)O)C(=O)C2CCS(=O)(=O)CC2 |
Computed by PubChem (NCBI)