Products 214420-47-0
CAS 214420-47-0 is the registry number for Melithiazole C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (2E,4R,5S,6E)-7-(2-acetyl-1,3-thiazol-4-yl)-3,5-dimethoxy-4-methylhepta-2,6-dienoate (CAS 214420-47-0) is a chemical compound with the molecular formula C16H21NO5S and a molecular weight of 339.4 g/mol. IUPAC name: methyl (2E,4R,5S,6E)-7-(2-acetyl-1,3-thiazol-4-yl)-3,5-dimethoxy-4-methylhepta-2,6-dienoate. InChIKey: LTTPICLGJAXUOJ-NSTYSWHMSA-N.
| Molecular formula | C16H21NO5S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | methyl (2E,4R,5S,6E)-7-(2-acetyl-1,3-thiazol-4-yl)-3,5-dimethoxy-4-methylhepta-2,6-dienoate |
| InChIKey | LTTPICLGJAXUOJ-NSTYSWHMSA-N |
| SMILES | C[C@H]([C@H](/C=C/C1=CSC(=N1)C(=O)C)OC)/C(=C\C(=O)OC)/OC |
Computed by PubChem (NCBI)
Synonyms:
Melithiazole C, orb3024509