Products 899710-19-1

CAS 899710-19-1 is the registry number for 5-(N-Butyl-N-ethylsulfamoyl)-3-methylbenzofuran-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[butyl(ethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid (CAS 899710-19-1) is a chemical compound with the molecular formula C16H21NO5S and a molecular weight of 339.4 g/mol. IUPAC name: 5-[butyl(ethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: ZNAUAGCDXWZECI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO5S
Molecular weight339.4 g/mol
IUPAC name5-[butyl(ethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid
InChIKeyZNAUAGCDXWZECI-UHFFFAOYSA-N
SMILESCCCCN(CC)S(=O)(=O)C1=CC2=C(C=C1)OC(=C2C)C(=O)O

Computed by PubChem (NCBI)