CAS 407627-51-4 appears in our catalog under these names: 2,3-Dimethyl-5-sulfo-3h-indole-3-hexanoic acid, 95%, 6-(2,3-Dimethyl-5-sulfo-3H-indol-3-yl)hexanoic acid, 97%, 2,3-Dimethyl-5-sulfo-3H-indole-3-hexanoic acid, 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo-, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 0,25g.
6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid (CAS 407627-51-4) is a chemical compound with the molecular formula C16H21NO5S and a molecular weight of 339.4 g/mol. IUPAC name: 6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid. InChIKey: GHCMZZOTVCLUBS-UHFFFAOYSA-N.
| Molecular formula | C16H21NO5S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid |
| InChIKey | GHCMZZOTVCLUBS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)CCCCCC(=O)O)C=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)