Products 909705-66-4
CAS 909705-66-4 is the registry number for 1-Oxotanshinone IIA. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,6,6-trimethyl-7,8-dihydronaphtho[1,2-g][1]benzofuran-9,10,11-trione (CAS 909705-66-4) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 308.3 g/mol. IUPAC name: 1,6,6-trimethyl-7,8-dihydronaphtho[1,2-g][1]benzofuran-9,10,11-trione. InChIKey: ZFNWSHVJUFFGLB-UHFFFAOYSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 1,6,6-trimethyl-7,8-dihydronaphtho[1,2-g][1]benzofuran-9,10,11-trione |
| InChIKey | ZFNWSHVJUFFGLB-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3C(=O)CCC4(C)C |
Computed by PubChem (NCBI)
Synonyms:
1-Oxotanshinone IIA, orb1941347