CAS 910237-79-5 is the registry number for Isoindolin-5-ylmethanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2,3-dihydro-1H-isoindol-5-ylmethanol;hydrochloride (CAS 910237-79-5) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 2,3-dihydro-1H-isoindol-5-ylmethanol;hydrochloride. InChIKey: KPJXRPGLPFOXPC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindol-5-ylmethanol;hydrochloride |
| InChIKey | KPJXRPGLPFOXPC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)CO.Cl |
Computed by PubChem (NCBI)