CAS 91063-60-4 is the registry number for 4-Chloro-2-(methylthio)-6-phenylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-2-methylsulfanyl-6-phenylpyrimidine (CAS 91063-60-4) is a chemical compound with the molecular formula C11H9ClN2S and a molecular weight of 236.72 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-6-phenylpyrimidine. InChIKey: ZEESGEQPRKDJCQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-6-phenylpyrimidine |
| InChIKey | ZEESGEQPRKDJCQ-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=CC(=N1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)