Products 911424-37-8
CAS 911424-37-8 is the registry number for 2-Cyano-3-[4-(dimethylamino)phenyl]prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoic acid (CAS 911424-37-8) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoic acid. InChIKey: CXZXLLVNQYUMAW-YFHOEESVSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoic acid |
| InChIKey | CXZXLLVNQYUMAW-YFHOEESVSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C(/C#N)\C(=O)O |
Computed by PubChem (NCBI)