CAS 91182-60-4 appears in our catalog under these names: 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid, 97%, 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid, 97%, 97%, 5-(4-Bromo-phenyl)-3-methyl-isoxazole-4-carboxylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylic acid (CAS 91182-60-4) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: GFLKZFOUAHOGJF-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | GFLKZFOUAHOGJF-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)