Products 91183-17-4
CAS 91183-17-4 appears in our catalog under these names: 5-(Benzyloxy)-2,4-dichloropyrimidine 98%, 5-(Benzyloxy)-2，4-dichloropyrimidine, 98%, 98%, 5-(Benzyloxy)-2,4-dichloropyrimidine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
2,4-dichloro-5-phenylmethoxypyrimidine (CAS 91183-17-4) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 2,4-dichloro-5-phenylmethoxypyrimidine. InChIKey: HICKLOUBWJHHFE-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2,4-dichloro-5-phenylmethoxypyrimidine |
| InChIKey | HICKLOUBWJHHFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)