CAS 912342-10-0 appears in our catalog under these names: (R)-Methyl 4-(1-aminoethyl)benzoate, 98%, 98%, (R)-Methyl 4-(1-aminoethyl)benzoate, 98%, (R)-Methyl 4-(1-aminoethyl)benzoate, 97%, Methyl-4-[(1R)-1-aminoethyl] benzoate, 97%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 10g, 100g.
Methyl 4-[(1R)-1-aminoethyl]benzoate (CAS 912342-10-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 4-[(1R)-1-aminoethyl]benzoate. InChIKey: XSYGLHLLQZGWPT-SSDOTTSWSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 4-[(1R)-1-aminoethyl]benzoate |
| InChIKey | XSYGLHLLQZGWPT-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)OC)N |
Computed by PubChem (NCBI)