Products 912824-68-1
CAS 912824-68-1 is the registry number for 2-Chloro-9-hydroxy-4h-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-9-hydroxypyrido[1,2-a]pyrimidin-4-one (CAS 912824-68-1) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 2-chloro-9-hydroxypyrido[1,2-a]pyrimidin-4-one. InChIKey: MONKCMUBXIANKO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 2-chloro-9-hydroxypyrido[1,2-a]pyrimidin-4-one |
| InChIKey | MONKCMUBXIANKO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=O)C=C(N=C2C(=C1)O)Cl |
Computed by PubChem (NCBI)