CAS 912838-55-2 is the registry number for N,2-Dimethyl-4-nitrobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,2-dimethyl-4-nitrobenzamide (CAS 912838-55-2) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: N,2-dimethyl-4-nitrobenzamide. InChIKey: DMPFAQRJNXALLH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N,2-dimethyl-4-nitrobenzamide |
| InChIKey | DMPFAQRJNXALLH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)NC |
Computed by PubChem (NCBI)