CAS 913702-34-8 appears in our catalog under these names: (R)-1,3'-Bipyrrolidine dihydrochloride, (R)-1,3'-Bipyrrolidine dihydrochloride, 97%, 97%, (R)-1,3'-Bipyrrolidine dihydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
1-[(3R)-pyrrolidin-3-yl]pyrrolidine;dihydrochloride (CAS 913702-34-8) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: 1-[(3R)-pyrrolidin-3-yl]pyrrolidine;dihydrochloride. InChIKey: BLXKBIQXWILCIT-YCBDHFTFSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | 1-[(3R)-pyrrolidin-3-yl]pyrrolidine;dihydrochloride |
| InChIKey | BLXKBIQXWILCIT-YCBDHFTFSA-N |
| SMILES | C1CCN(C1)[C@@H]2CCNC2.Cl.Cl |
Computed by PubChem (NCBI)