Products 913744-63-5
CAS 913744-63-5 is the registry number for rac-1-tert-Butyl 3-methyl (3R,4R)-4-cyclopropylpyrrolidine-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-O-tert-butyl 3-O-methyl (3R,4R)-4-cyclopropylpyrrolidine-1,3-dicarboxylate (CAS 913744-63-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,4R)-4-cyclopropylpyrrolidine-1,3-dicarboxylate. InChIKey: UJFBKQAYFROGQA-MNOVXSKESA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,4R)-4-cyclopropylpyrrolidine-1,3-dicarboxylate |
| InChIKey | UJFBKQAYFROGQA-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)OC)C2CC2 |
Computed by PubChem (NCBI)