CAS 914605-77-9 is the registry number for Methyl 4-(3-nitrophenoxy)butanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 4-(3-nitrophenoxy)butanoate (CAS 914605-77-9) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: methyl 4-(3-nitrophenoxy)butanoate. InChIKey: OXKQRXUDMCYHBP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | methyl 4-(3-nitrophenoxy)butanoate |
| InChIKey | OXKQRXUDMCYHBP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOC1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)