Products 914637-34-6
CAS 914637-34-6 appears in our catalog under these names: 5-Tert-butyl-1,3-oxazole-4-carboxylic Acid, 4-Oxazolecarboxylic acid, 5-(1,1-dimethylethyl)-, 97%, 97%, 5-TERT-BUTYL-1,3-OXAZOLE-4-CARBOXYLIC ACID, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 100mg, 250mg.
5-tert-butyl-1,3-oxazole-4-carboxylic acid (CAS 914637-34-6) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-tert-butyl-1,3-oxazole-4-carboxylic acid. InChIKey: ZCFUUADBHFEUFP-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-tert-butyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZCFUUADBHFEUFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(N=CO1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-tert-butyl-1,3-oxazole-4-carboxylic acid, 5-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid, 5-tert-Butyl-oxazole-4-carboxylic acid, 5-(tert-Butyl)-1,3-oxazole-4-carboxylic acid, 4-Oxazolecarboxylic acid, 5-(1,1-dimethylethyl)-, 5-(tert-Butyl)oxazole-4-carboxylic Acid, 5-tert-butyloxazole-4-carboxylic acid, 5-tert-Butyl-oxazol-4-carboxylic acid, 5-tert-butyl-1,3-oxazole-4-carboxylicacid