CAS 914988-10-6 appears in our catalog under these names: 3-Cyano-4-oxo-piperidine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 3-cyano-4-oxopiperidine-1-carboxylate, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100g, 500g.
Tert-butyl 3-cyano-4-oxopiperidine-1-carboxylate (CAS 914988-10-6) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: tert-butyl 3-cyano-4-oxopiperidine-1-carboxylate. InChIKey: VPFTZTMJPFIRAN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | tert-butyl 3-cyano-4-oxopiperidine-1-carboxylate |
| InChIKey | VPFTZTMJPFIRAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)C#N |
Computed by PubChem (NCBI)