Products 915235-16-4

CAS 915235-16-4 is the registry number for Xanthorrhizol Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

6-hydroxy-4-[(2R)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one (CAS 915235-16-4) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 6-hydroxy-4-[(2R)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one. InChIKey: NLRKVPMURLQGJL-LKSINWNRSA-N.

Identity
Molecular formulaC14H22O2
Molecular weight222.32 g/mol
IUPAC name6-hydroxy-4-[(2R)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one
InChIKeyNLRKVPMURLQGJL-LKSINWNRSA-N
SMILESC[C@H](CCC=C(C)C)C1CC(C(=O)C=C1)O

Computed by PubChem (NCBI)