CAS 915376-88-4 appears in our catalog under these names: 2-Methyl-3-nitrophenethyl 4-methylbenzenesulfonate, Ropinirole Impurity 10. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
2-(2-methyl-3-nitrophenyl)ethyl 4-methylbenzenesulfonate (CAS 915376-88-4) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 2-(2-methyl-3-nitrophenyl)ethyl 4-methylbenzenesulfonate. InChIKey: IBYANROAZAKRDP-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-(2-methyl-3-nitrophenyl)ethyl 4-methylbenzenesulfonate |
| InChIKey | IBYANROAZAKRDP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2=C(C(=CC=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)