Products 915378-82-4
CAS 915378-82-4 is the registry number for Resveratrol analog 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(E)-2-(3-fluoro-5-hydroxyphenyl)ethenyl]phenyl] acetate (CAS 915378-82-4) is a chemical compound with the molecular formula C16H13FO3 and a molecular weight of 272.27 g/mol. IUPAC name: [4-[(E)-2-(3-fluoro-5-hydroxyphenyl)ethenyl]phenyl] acetate. InChIKey: OAKXGWWZEKTFJH-NSCUHMNNSA-N.
| Molecular formula | C16H13FO3 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | [4-[(E)-2-(3-fluoro-5-hydroxyphenyl)ethenyl]phenyl] acetate |
| InChIKey | OAKXGWWZEKTFJH-NSCUHMNNSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)F)O |
Computed by PubChem (NCBI)