CAS 915919-98-1 appears in our catalog under these names: 2,2-Dimethyl-1-(2-thienyl)cyclopropanecarboxylic acid, 95%, 2,2-Dimethyl-1-(thiophen-2-yl)cyclopropanecarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2,2-dimethyl-1-thiophen-2-ylcyclopropane-1-carboxylic acid (CAS 915919-98-1) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 2,2-dimethyl-1-thiophen-2-ylcyclopropane-1-carboxylic acid. InChIKey: PYCZYXYIEAWQSJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 2,2-dimethyl-1-thiophen-2-ylcyclopropane-1-carboxylic acid |
| InChIKey | PYCZYXYIEAWQSJ-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=CS2)C(=O)O)C |
Computed by PubChem (NCBI)