CAS 915924-30-0 is the registry number for (2E)-3-[2-(Methylthio)pyrimidin-5-yl]acrylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
(E)-3-(2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid (CAS 915924-30-0) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: (E)-3-(2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid. InChIKey: WPRBLLNMSHVARX-NSCUHMNNSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | (E)-3-(2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid |
| InChIKey | WPRBLLNMSHVARX-NSCUHMNNSA-N |
| SMILES | CSC1=NC=C(C=N1)/C=C/C(=O)O |
Computed by PubChem (NCBI)