CAS 916198-97-5 appears in our catalog under these names: (S)-4-Amino-5-phenylpentanoic acid, 98+%, γ–Amino–benzenepentanoic Acid, (S)-4-Amino-5-phenylpentanoic acid, ≥98%, ≥98%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 10g, 100mg, 1g, 250mg, 10mg, 25mg, 50mg.
(4S)-4-amino-5-phenylpentanoic acid (CAS 916198-97-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (4S)-4-amino-5-phenylpentanoic acid. InChIKey: URBAOHLJWLYLQE-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (4S)-4-amino-5-phenylpentanoic acid |
| InChIKey | URBAOHLJWLYLQE-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CCC(=O)O)N |
Computed by PubChem (NCBI)