CAS 916214-30-7 appears in our catalog under these names: (S)-1-Boc-3-aminomethylpyrrolidine hydrochloride, 95%, (S)–1–Boc–3–Aminomethylpyrrolidine hydrochloride, (S)-1-Boc-3-Aminomethylpyrrolidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
Tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 916214-30-7) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: QKIJZDUDCUIGGM-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | QKIJZDUDCUIGGM-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CN.Cl |
Computed by PubChem (NCBI)