Products 916975-92-3
CAS 916975-92-3 appears in our catalog under these names: Nilotinib Impurity 15, 4-Methyl-1-(3-nitro-5-(trifluoromethyl)phenyl)-1H-imidazole, >95% (HPLC), 4-Methyl-1-(3-nitro-5-(trifluoromethyl)phenyl)-1H-imidazole 95+%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 100mg, 1g.
4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole (CAS 916975-92-3) is a chemical compound with the molecular formula C11H8F3N3O2 and a molecular weight of 271.19 g/mol. IUPAC name: 4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole. InChIKey: JMLCVCGQBRZYOZ-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O2 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 4-methyl-1-[3-nitro-5-(trifluoromethyl)phenyl]imidazole |
| InChIKey | JMLCVCGQBRZYOZ-UHFFFAOYSA-N |
| SMILES | CC1=CN(C=N1)C2=CC(=CC(=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)