Products 91725-39-2
CAS 91725-39-2 is the registry number for Cysteine Betaine. Offered by: TRC. Available pack sizes: 25mg.
(1-carboxy-2-sulfanylethyl)-trimethylazanium chloride (CAS 91725-39-2) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (1-carboxy-2-sulfanylethyl)-trimethylazanium chloride. InChIKey: RLXSYVULVFGYGU-UHFFFAOYSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (1-carboxy-2-sulfanylethyl)-trimethylazanium chloride |
| InChIKey | RLXSYVULVFGYGU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C(CS)C(=O)O.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Cysteine Betaine