CAS 917251-99-1 appears in our catalog under these names: 8–Bromo–5–fluoroquinoline, 8-Bromo-5-fluoroquinoline 95%, 8-bromo-5-fluoroquinoline, 97%, 97%, 8-Bromo-5-fluoroquinoline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
8-bromo-5-fluoroquinoline (CAS 917251-99-1) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 8-bromo-5-fluoroquinoline. InChIKey: OUZLPGJFGCOKJJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 8-bromo-5-fluoroquinoline |
| InChIKey | OUZLPGJFGCOKJJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Br)F |
Computed by PubChem (NCBI)