CAS 917344-37-7 appears in our catalog under these names: 6-Methoxypyrido[3,2-b]pyrazin-3(4h)-one, 95%, 6-Methoxypyrido(3,2-b)pyrazin-3(4H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
6-methoxy-4H-pyrido[2,3-b]pyrazin-3-one (CAS 917344-37-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 6-methoxy-4H-pyrido[2,3-b]pyrazin-3-one. InChIKey: KQQOCTNNXMAEPD-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-methoxy-4H-pyrido[2,3-b]pyrazin-3-one |
| InChIKey | KQQOCTNNXMAEPD-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=CC(=O)N2 |
Computed by PubChem (NCBI)