CAS 91759-61-4 is the registry number for (5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetic acid (CAS 91759-61-4) is a chemical compound with the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. IUPAC name: 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetic acid. InChIKey: XLEIQDYORCVELY-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4 |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetic acid |
| InChIKey | XLEIQDYORCVELY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN(N=N2)CC(=O)O)OC |
Computed by PubChem (NCBI)