CAS 91971-63-0 is the registry number for 4-Allyl-2-methoxyphenyl Methanesulfonate. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(2-methoxy-4-prop-2-enylphenyl) methanesulfonate (CAS 91971-63-0) is a chemical compound with the molecular formula C11H14O4S and a molecular weight of 242.29 g/mol. IUPAC name: (2-methoxy-4-prop-2-enylphenyl) methanesulfonate. InChIKey: LNRYAPPBUKXOTG-UHFFFAOYSA-N.
| Molecular formula | C11H14O4S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | (2-methoxy-4-prop-2-enylphenyl) methanesulfonate |
| InChIKey | LNRYAPPBUKXOTG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC=C)OS(=O)(=O)C |
Computed by PubChem (NCBI)